C16H20FN3O2 — CID 132648969
3-[(4-fluorophenoxy)methyl]-1-(1H-imidazol-2-ylmethyl)piperidin-3-ol (PubChem CID 132648969) has the molecular formula C16H20FN3O2 and a molecular weight of 305.35 g/mol. Its IUPAC name is 3-[(4-fluorophenoxy)methyl]-1-(1H-imidazol-2-ylmethyl)piperidin-3-ol.
| Compound Name | 3-[(4-fluorophenoxy)methyl]-1-(1H-imidazol-2-ylmethyl)piperidin-3-ol |
|---|---|
| PubChem CID | 132648969 |
| Molecular Formula | C16H20FN3O2 |
| Molecular Weight | 305.35 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | 3-[(4-fluorophenoxy)methyl]-1-(1H-imidazol-2-ylmethyl)piperidin-3-ol |
| SMILES | OC1(COc2ccc(F)cc2)CCCN(Cc2ncc[nH]2)C1 |
| InChI | InChI=1S/C16H20FN3O2/c17-13-2-4-14(5-3-13)22-12-16(21)6-1-9-20(11-16)10-15-18-7-8-19-15/h2-5,7-8,21H,1,6,9-12H2,(H,18,19) |
| InChIKey | XWXJZTWTFDFZCD-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 61.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.35 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |