C17H22FN3O2 — CID 155990623
3-[(4-fluorophenoxy)methyl]-1-[(1-methylpyrazol-3-yl)methyl]piperidin-3-ol (PubChem CID 155990623) has the molecular formula C17H22FN3O2 and a molecular weight of 319.38 g/mol. Its IUPAC name is 3-[(4-fluorophenoxy)methyl]-1-[(1-methylpyrazol-3-yl)methyl]piperidin-3-ol.
| Compound Name | 3-[(4-fluorophenoxy)methyl]-1-[(1-methylpyrazol-3-yl)methyl]piperidin-3-ol |
|---|---|
| PubChem CID | 155990623 |
| Molecular Formula | C17H22FN3O2 |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | 3-[(4-fluorophenoxy)methyl]-1-[(1-methylpyrazol-3-yl)methyl]piperidin-3-ol |
| SMILES | Cn1ccc(CN2CCCC(O)(COc3ccc(F)cc3)C2)n1 |
| InChI | InChI=1S/C17H22FN3O2/c1-20-10-7-15(19-20)11-21-9-2-8-17(22,12-21)13-23-16-5-3-14(18)4-6-16/h3-7,10,22H,2,8-9,11-13H2,1H3 |
| InChIKey | NGLNJOZQFZYNIJ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |