C18H22FN3O3 — CID 155990699
[4-[(4-fluorophenoxy)methyl]-4-hydroxyazepan-1-yl]-(1-methylpyrazol-3-yl)methanone (PubChem CID 155990699) has the molecular formula C18H22FN3O3 and a molecular weight of 347.39 g/mol. Its IUPAC name is [4-[(4-fluorophenoxy)methyl]-4-hydroxyazepan-1-yl]-(1-methylpyrazol-3-yl)methanone.
| Compound Name | [4-[(4-fluorophenoxy)methyl]-4-hydroxyazepan-1-yl]-(1-methylpyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 155990699 |
| Molecular Formula | C18H22FN3O3 |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | [4-[(4-fluorophenoxy)methyl]-4-hydroxyazepan-1-yl]-(1-methylpyrazol-3-yl)methanone |
| SMILES | Cn1ccc(C(=O)N2CCCC(O)(COc3ccc(F)cc3)CC2)n1 |
| InChI | InChI=1S/C18H22FN3O3/c1-21-11-7-16(20-21)17(23)22-10-2-8-18(24,9-12-22)13-25-15-5-3-14(19)4-6-15/h3-7,11,24H,2,8-10,12-13H2,1H3 |
| InChIKey | SSCZTGSOWHNBPY-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |