C20H21F2NO3 — CID 155991718
(3,5-difluorophenyl)-[4-hydroxy-4-(phenoxymethyl)azepan-1-yl]methanone (PubChem CID 155991718) has the molecular formula C20H21F2NO3 and a molecular weight of 361.39 g/mol. Its IUPAC name is (3,5-difluorophenyl)-[4-hydroxy-4-(phenoxymethyl)azepan-1-yl]methanone.
| Compound Name | (3,5-difluorophenyl)-[4-hydroxy-4-(phenoxymethyl)azepan-1-yl]methanone |
|---|---|
| PubChem CID | 155991718 |
| Molecular Formula | C20H21F2NO3 |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | (3,5-difluorophenyl)-[4-hydroxy-4-(phenoxymethyl)azepan-1-yl]methanone |
| SMILES | O=C(c1cc(F)cc(F)c1)N1CCCC(O)(COc2ccccc2)CC1 |
| InChI | InChI=1S/C20H21F2NO3/c21-16-11-15(12-17(22)13-16)19(24)23-9-4-7-20(25,8-10-23)14-26-18-5-2-1-3-6-18/h1-3,5-6,11-13,25H,4,7-10,14H2 |
| InChIKey | NMHJOYTVXYCNHI-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |