C17H21N3O3 — CID 155991697
[4-hydroxy-4-(phenoxymethyl)azepan-1-yl]-(1H-pyrazol-5-yl)methanone (PubChem CID 155991697) has the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. Its IUPAC name is [4-hydroxy-4-(phenoxymethyl)azepan-1-yl]-(1H-pyrazol-5-yl)methanone.
| Compound Name | [4-hydroxy-4-(phenoxymethyl)azepan-1-yl]-(1H-pyrazol-5-yl)methanone |
|---|---|
| PubChem CID | 155991697 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | [4-hydroxy-4-(phenoxymethyl)azepan-1-yl]-(1H-pyrazol-5-yl)methanone |
| SMILES | O=C(c1ccn[nH]1)N1CCCC(O)(COc2ccccc2)CC1 |
| InChI | InChI=1S/C17H21N3O3/c21-16(15-7-10-18-19-15)20-11-4-8-17(22,9-12-20)13-23-14-5-2-1-3-6-14/h1-3,5-7,10,22H,4,8-9,11-13H2,(H,18,19) |
| InChIKey | WKPHXCMPRGLBJK-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 78.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |