C21H24FN3O4 — CID 155991080
N-[4-[4-[(4-fluorophenoxy)methyl]-4-hydroxyazepane-1-carbonyl]-2-pyridinyl]acetamide (PubChem CID 155991080) has the molecular formula C21H24FN3O4 and a molecular weight of 401.44 g/mol. Its IUPAC name is N-[4-[4-[(4-fluorophenoxy)methyl]-4-hydroxyazepane-1-carbonyl]-2-pyridinyl]acetamide.
| Compound Name | N-[4-[4-[(4-fluorophenoxy)methyl]-4-hydroxyazepane-1-carbonyl]-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 155991080 |
| Molecular Formula | C21H24FN3O4 |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | N-[4-[4-[(4-fluorophenoxy)methyl]-4-hydroxyazepane-1-carbonyl]-2-pyridinyl]acetamide |
| SMILES | CC(=O)Nc1cc(C(=O)N2CCCC(O)(COc3ccc(F)cc3)CC2)ccn1 |
| InChI | InChI=1S/C21H24FN3O4/c1-15(26)24-19-13-16(7-10-23-19)20(27)25-11-2-8-21(28,9-12-25)14-29-18-5-3-17(22)4-6-18/h3-7,10,13,28H,2,8-9,11-12,14H2,1H3,(H,23,24,26) |
| InChIKey | IRSLKCMADMDJDZ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |