C21H24FNO3 — CID 155991254
[4-[(4-fluorophenoxy)methyl]-4-hydroxyazepan-1-yl]-(3-methylphenyl)methanone (PubChem CID 155991254) has the molecular formula C21H24FNO3 and a molecular weight of 357.43 g/mol. Its IUPAC name is [4-[(4-fluorophenoxy)methyl]-4-hydroxyazepan-1-yl]-(3-methylphenyl)methanone.
| Compound Name | [4-[(4-fluorophenoxy)methyl]-4-hydroxyazepan-1-yl]-(3-methylphenyl)methanone |
|---|---|
| PubChem CID | 155991254 |
| Molecular Formula | C21H24FNO3 |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | [4-[(4-fluorophenoxy)methyl]-4-hydroxyazepan-1-yl]-(3-methylphenyl)methanone |
| SMILES | Cc1cccc(C(=O)N2CCCC(O)(COc3ccc(F)cc3)CC2)c1 |
| InChI | InChI=1S/C21H24FNO3/c1-16-4-2-5-17(14-16)20(24)23-12-3-10-21(25,11-13-23)15-26-19-8-6-18(22)7-9-19/h2,4-9,14,25H,3,10-13,15H2,1H3 |
| InChIKey | JXXSPGXAJBDCOU-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |