About (1-benzyl-1-methylpiperidin-1-ium-4-yl) N-benzhydrylcarbamate
(1-benzyl-1-methylpiperidin-1-ium-4-yl) N-benzhydrylcarbamate (PubChem CID 10768844) has the molecular formula C27H31N2O2+
and a molecular weight of 415.56 g/mol. Its IUPAC name is (1-benzyl-1-methylpiperidin-1-ium-4-yl) N-benzhydrylcarbamate.
Molecular Properties
| Compound Name | (1-benzyl-1-methylpiperidin-1-ium-4-yl) N-benzhydrylcarbamate |
| PubChem CID | 10768844 |
| Molecular Formula | C27H31N2O2+ |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.24 |
| IUPAC Name | (1-benzyl-1-methylpiperidin-1-ium-4-yl) N-benzhydrylcarbamate |
| SMILES | C[N+]1(Cc2ccccc2)CCC(OC(=O)NC(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C27H30N2O2/c1-29(21-22-11-5-2-6-12-22)19-17-25(18-20-29)31-27(30)28-26(23-13-7-3-8-14-23)24-15-9-4-10-16-24/h2-16,25-26H,17-21H2,1H3/p+1 |
| InChIKey | OGLQEKUMJCDEQF-UHFFFAOYSA-O |
| XLogP | 5.31 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze (1-benzyl-1-methylpiperidin-1-ium-4-yl) N-benzhydrylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-benzyl-1-methylpiperidin-1-ium-4-yl) N-benzhydrylcarbamate?
The IUPAC name of (1-benzyl-1-methylpiperidin-1-ium-4-yl) N-benzhydrylcarbamate (CID 10768844) is (1-benzyl-1-methylpiperidin-1-ium-4-yl) N-benzhydrylcarbamate.
What is the SMILES notation for (1-benzyl-1-methylpiperidin-1-ium-4-yl) N-benzhydrylcarbamate?
The canonical SMILES for (1-benzyl-1-methylpiperidin-1-ium-4-yl) N-benzhydrylcarbamate is C[N+]1(Cc2ccccc2)CCC(OC(=O)NC(c2ccccc2)c2ccccc2)CC1.
What is the InChIKey of (1-benzyl-1-methylpiperidin-1-ium-4-yl) N-benzhydrylcarbamate?
The InChIKey is OGLQEKUMJCDEQF-UHFFFAOYSA-O. The full InChI is InChI=1S/C27H30N2O2/c1-29(21-22-11-5-2-6-12-22)19-17-25(18-20-29)31-27(30)28-26(23-13-7-3-8-14-23)24-15-9-4-10-16-24/h2-16,25-26H,17-21H2,1H3/p+1.
What are the key properties of (1-benzyl-1-methylpiperidin-1-ium-4-yl) N-benzhydrylcarbamate?
(1-benzyl-1-methylpiperidin-1-ium-4-yl) N-benzhydrylcarbamate has a molecular weight of 415.56 g/mol, XLogP of 5.31, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-benzyl-1-methylpiperidin-1-ium-4-yl) N-benzhydrylcarbamate is sourced from PubChem (CID 10768844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).