C18H17NO3 — CID 139935383
cyclopropyl N-(2,2-diphenylacetyl)carbamate (PubChem CID 139935383) has the molecular formula C18H17NO3 and a molecular weight of 295.34 g/mol. Its IUPAC name is cyclopropyl N-(2,2-diphenylacetyl)carbamate.
| Compound Name | cyclopropyl N-(2,2-diphenylacetyl)carbamate |
|---|---|
| PubChem CID | 139935383 |
| Molecular Formula | C18H17NO3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | cyclopropyl N-(2,2-diphenylacetyl)carbamate |
| SMILES | O=C(NC(=O)C(c1ccccc1)c1ccccc1)OC1CC1 |
| InChI | InChI=1S/C18H17NO3/c20-17(19-18(21)22-15-11-12-15)16(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,15-16H,11-12H2,(H,19,20,21) |
| InChIKey | RSLYKPQFFLZHEA-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |