C21H25N3O3 — CID 23744527
[2-[(1-benzylpiperidin-4-yl)amino]-2-oxoethyl] 3-aminobenzoate (PubChem CID 23744527) has the molecular formula C21H25N3O3 and a molecular weight of 367.45 g/mol. Its IUPAC name is [2-[(1-benzylpiperidin-4-yl)amino]-2-oxoethyl] 3-aminobenzoate.
| Compound Name | [2-[(1-benzylpiperidin-4-yl)amino]-2-oxoethyl] 3-aminobenzoate |
|---|---|
| PubChem CID | 23744527 |
| Molecular Formula | C21H25N3O3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | [2-[(1-benzylpiperidin-4-yl)amino]-2-oxoethyl] 3-aminobenzoate |
| SMILES | Nc1cccc(C(=O)OCC(=O)NC2CCN(Cc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C21H25N3O3/c22-18-8-4-7-17(13-18)21(26)27-15-20(25)23-19-9-11-24(12-10-19)14-16-5-2-1-3-6-16/h1-8,13,19H,9-12,14-15,22H2,(H,23,25) |
| InChIKey | TULWOPAZEDQVPE-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|