C24H26N4O3 — CID 23887792
[2-[(1-benzylpiperidin-4-yl)amino]-2-oxoethyl] 4-(1H-imidazol-2-yl)benzoate (PubChem CID 23887792) has the molecular formula C24H26N4O3 and a molecular weight of 418.50 g/mol. Its IUPAC name is [2-[(1-benzylpiperidin-4-yl)amino]-2-oxoethyl] 4-(1H-imidazol-2-yl)benzoate.
| Compound Name | [2-[(1-benzylpiperidin-4-yl)amino]-2-oxoethyl] 4-(1H-imidazol-2-yl)benzoate |
|---|---|
| PubChem CID | 23887792 |
| Molecular Formula | C24H26N4O3 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | [2-[(1-benzylpiperidin-4-yl)amino]-2-oxoethyl] 4-(1H-imidazol-2-yl)benzoate |
| SMILES | O=C(COC(=O)c1ccc(-c2ncc[nH]2)cc1)NC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C24H26N4O3/c29-22(27-21-10-14-28(15-11-21)16-18-4-2-1-3-5-18)17-31-24(30)20-8-6-19(7-9-20)23-25-12-13-26-23/h1-9,12-13,21H,10-11,14-17H2,(H,25,26)(H,27,29) |
| InChIKey | QIHYHJQKILGOSR-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |