C18H22N4 — CID 133342726
4-(4-propyl-1,4-diazepan-1-yl)quinoline-3-carbonitrile (PubChem CID 133342726) has the molecular formula C18H22N4 and a molecular weight of 294.40 g/mol. Its IUPAC name is 4-(4-propyl-1,4-diazepan-1-yl)quinoline-3-carbonitrile.
| Compound Name | 4-(4-propyl-1,4-diazepan-1-yl)quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 133342726 |
| Molecular Formula | C18H22N4 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | 4-(4-propyl-1,4-diazepan-1-yl)quinoline-3-carbonitrile |
| SMILES | CCCN1CCCN(c2c(C#N)cnc3ccccc23)CC1 |
| InChI | InChI=1S/C18H22N4/c1-2-8-21-9-5-10-22(12-11-21)18-15(13-19)14-20-17-7-4-3-6-16(17)18/h3-4,6-7,14H,2,5,8-12H2,1H3 |
| InChIKey | WXQQCMZNRSALBA-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 43.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |