C14H13N3O2S — CID 43669154
4-(1,1-dioxo-1,4-thiazinan-4-yl)quinoline-3-carbonitrile (PubChem CID 43669154) has the molecular formula C14H13N3O2S and a molecular weight of 287.34 g/mol. Its IUPAC name is 4-(1,1-dioxo-1,4-thiazinan-4-yl)quinoline-3-carbonitrile.
| Compound Name | 4-(1,1-dioxo-1,4-thiazinan-4-yl)quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 43669154 |
| Molecular Formula | C14H13N3O2S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 4-(1,1-dioxo-1,4-thiazinan-4-yl)quinoline-3-carbonitrile |
| SMILES | N#Cc1cnc2ccccc2c1N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C14H13N3O2S/c15-9-11-10-16-13-4-2-1-3-12(13)14(11)17-5-7-20(18,19)8-6-17/h1-4,10H,5-8H2 |
| InChIKey | KGPPAFPHWWZPDA-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 74.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |