C16H18N4 — CID 43669097
4-(4-methyl-1,4-diazepan-1-yl)quinoline-3-carbonitrile (PubChem CID 43669097) has the molecular formula C16H18N4 and a molecular weight of 266.35 g/mol. Its IUPAC name is 4-(4-methyl-1,4-diazepan-1-yl)quinoline-3-carbonitrile.
| Compound Name | 4-(4-methyl-1,4-diazepan-1-yl)quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 43669097 |
| Molecular Formula | C16H18N4 |
| Molecular Weight | 266.35 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 4-(4-methyl-1,4-diazepan-1-yl)quinoline-3-carbonitrile |
| SMILES | CN1CCCN(c2c(C#N)cnc3ccccc23)CC1 |
| InChI | InChI=1S/C16H18N4/c1-19-7-4-8-20(10-9-19)16-13(11-17)12-18-15-6-3-2-5-14(15)16/h2-3,5-6,12H,4,7-10H2,1H3 |
| InChIKey | HDQNUZDROCKPGH-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 43.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.35 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |