C17H19N3O — CID 107392588
4-(3-methoxy-3-methylpiperidin-1-yl)quinoline-3-carbonitrile (PubChem CID 107392588) has the molecular formula C17H19N3O and a molecular weight of 281.36 g/mol. Its IUPAC name is 4-(3-methoxy-3-methylpiperidin-1-yl)quinoline-3-carbonitrile.
| Compound Name | 4-(3-methoxy-3-methylpiperidin-1-yl)quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 107392588 |
| Molecular Formula | C17H19N3O |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 4-(3-methoxy-3-methylpiperidin-1-yl)quinoline-3-carbonitrile |
| SMILES | COC1(C)CCCN(c2c(C#N)cnc3ccccc23)C1 |
| InChI | InChI=1S/C17H19N3O/c1-17(21-2)8-5-9-20(12-17)16-13(10-18)11-19-15-7-4-3-6-14(15)16/h3-4,6-7,11H,5,8-9,12H2,1-2H3 |
| InChIKey | BYNGRBXBRUEZEC-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 49.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |