C19H27N3O6S — CID 175341820
2-[1-(3,6,7-trimethoxyquinolin-4-yl)piperidin-4-yl]ethyl sulfamate (PubChem CID 175341820) has the molecular formula C19H27N3O6S and a molecular weight of 425.51 g/mol. Its IUPAC name is 2-[1-(3,6,7-trimethoxyquinolin-4-yl)piperidin-4-yl]ethyl sulfamate.
| Compound Name | 2-[1-(3,6,7-trimethoxyquinolin-4-yl)piperidin-4-yl]ethyl sulfamate |
|---|---|
| PubChem CID | 175341820 |
| Molecular Formula | C19H27N3O6S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | 2-[1-(3,6,7-trimethoxyquinolin-4-yl)piperidin-4-yl]ethyl sulfamate |
| SMILES | COc1cc2ncc(OC)c(N3CCC(CCOS(N)(=O)=O)CC3)c2cc1OC |
| InChI | InChI=1S/C19H27N3O6S/c1-25-16-10-14-15(11-17(16)26-2)21-12-18(27-3)19(14)22-7-4-13(5-8-22)6-9-28-29(20,23)24/h10-13H,4-9H2,1-3H3,(H2,20,23,24) |
| InChIKey | ZQSRQEPRKBYSMP-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 113.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |