C16H23N5O4S — CID 167049154
6,7-dimethoxy-4-[4-[methyl(sulfamoyl)amino]piperidin-1-yl]quinazoline (PubChem CID 167049154) has the molecular formula C16H23N5O4S and a molecular weight of 381.46 g/mol. Its IUPAC name is 6,7-dimethoxy-4-[4-[methyl(sulfamoyl)amino]piperidin-1-yl]quinazoline.
| Compound Name | 6,7-dimethoxy-4-[4-[methyl(sulfamoyl)amino]piperidin-1-yl]quinazoline |
|---|---|
| PubChem CID | 167049154 |
| Molecular Formula | C16H23N5O4S |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 6,7-dimethoxy-4-[4-[methyl(sulfamoyl)amino]piperidin-1-yl]quinazoline |
| SMILES | COc1cc2ncnc(N3CCC(N(C)S(N)(=O)=O)CC3)c2cc1OC |
| InChI | InChI=1S/C16H23N5O4S/c1-20(26(17,22)23)11-4-6-21(7-5-11)16-12-8-14(24-2)15(25-3)9-13(12)18-10-19-16/h8-11H,4-7H2,1-3H3,(H2,17,22,23) |
| InChIKey | UQNFZLFUVMRRES-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |