C19H28N4O2 — CID 155128602
(2S)-2-[1-(6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]butan-1-amine (PubChem CID 155128602) has the molecular formula C19H28N4O2 and a molecular weight of 344.46 g/mol. Its IUPAC name is (2S)-2-[1-(6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]butan-1-amine.
| Compound Name | (2S)-2-[1-(6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]butan-1-amine |
|---|---|
| PubChem CID | 155128602 |
| Molecular Formula | C19H28N4O2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | (2S)-2-[1-(6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]butan-1-amine |
| SMILES | CC[C@H](CN)C1CCN(c2ncnc3cc(OC)c(OC)cc23)CC1 |
| InChI | InChI=1S/C19H28N4O2/c1-4-13(11-20)14-5-7-23(8-6-14)19-15-9-17(24-2)18(25-3)10-16(15)21-12-22-19/h9-10,12-14H,4-8,11,20H2,1-3H3/t13-/m1/s1 |
| InChIKey | WUXDSCOOPNNHKB-CYBMUJFWSA-N |
| XLogP | 2.85 |
| TPSA | 73.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |