C19H24N3O3P — CID 167659633
2-[1-(3-cyano-6,7-dimethylquinolin-4-yl)piperidin-4-yl]ethylphosphonic acid (PubChem CID 167659633) has the molecular formula C19H24N3O3P and a molecular weight of 373.39 g/mol. Its IUPAC name is 2-[1-(3-cyano-6,7-dimethylquinolin-4-yl)piperidin-4-yl]ethylphosphonic acid.
| Compound Name | 2-[1-(3-cyano-6,7-dimethylquinolin-4-yl)piperidin-4-yl]ethylphosphonic acid |
|---|---|
| PubChem CID | 167659633 |
| Molecular Formula | C19H24N3O3P |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 2-[1-(3-cyano-6,7-dimethylquinolin-4-yl)piperidin-4-yl]ethylphosphonic acid |
| SMILES | Cc1cc2ncc(C#N)c(N3CCC(CCP(=O)(O)O)CC3)c2cc1C |
| InChI | InChI=1S/C19H24N3O3P/c1-13-9-17-18(10-14(13)2)21-12-16(11-20)19(17)22-6-3-15(4-7-22)5-8-26(23,24)25/h9-10,12,15H,3-8H2,1-2H3,(H2,23,24,25) |
| InChIKey | RTQBPODYQXVNNH-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 97.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|