C18H28N6O2S — CID 153348949
S-[2-[1-[6,7-dimethoxy-2-(methylamino)quinazolin-4-yl]piperidin-4-yl]ethylamino]thiohydroxylamine (PubChem CID 153348949) has the molecular formula C18H28N6O2S and a molecular weight of 392.53 g/mol. Its IUPAC name is S-[2-[1-[6,7-dimethoxy-2-(methylamino)quinazolin-4-yl]piperidin-4-yl]ethylamino]thiohydroxylamine.
| Compound Name | S-[2-[1-[6,7-dimethoxy-2-(methylamino)quinazolin-4-yl]piperidin-4-yl]ethylamino]thiohydroxylamine |
|---|---|
| PubChem CID | 153348949 |
| Molecular Formula | C18H28N6O2S |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | S-[2-[1-[6,7-dimethoxy-2-(methylamino)quinazolin-4-yl]piperidin-4-yl]ethylamino]thiohydroxylamine |
| SMILES | CNc1nc(N2CCC(CCNSN)CC2)c2cc(OC)c(OC)cc2n1 |
| InChI | InChI=1S/C18H28N6O2S/c1-20-18-22-14-11-16(26-3)15(25-2)10-13(14)17(23-18)24-8-5-12(6-9-24)4-7-21-27-19/h10-12,21H,4-9,19H2,1-3H3,(H,20,22,23) |
| InChIKey | UKWLRZFGLPATQO-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 97.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|