C17H24N5O4S- — CID 154630897
2-amino-6,7-dimethoxy-4-[4-[2-(sulfinatoamino)ethyl]piperidin-1-yl]quinazoline (PubChem CID 154630897) has the molecular formula C17H24N5O4S- and a molecular weight of 394.48 g/mol. Its IUPAC name is 2-amino-6,7-dimethoxy-4-[4-[2-(sulfinatoamino)ethyl]piperidin-1-yl]quinazoline.
| Compound Name | 2-amino-6,7-dimethoxy-4-[4-[2-(sulfinatoamino)ethyl]piperidin-1-yl]quinazoline |
|---|---|
| PubChem CID | 154630897 |
| Molecular Formula | C17H24N5O4S- |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | 2-amino-6,7-dimethoxy-4-[4-[2-(sulfinatoamino)ethyl]piperidin-1-yl]quinazoline |
| SMILES | COc1cc2nc(N)nc(N3CCC(CCNS(=O)[O-])CC3)c2cc1OC |
| InChI | InChI=1S/C17H25N5O4S/c1-25-14-9-12-13(10-15(14)26-2)20-17(18)21-16(12)22-7-4-11(5-8-22)3-6-19-27(23)24/h9-11,19H,3-8H2,1-2H3,(H,23,24)(H2,18,20,21)/p-1 |
| InChIKey | VGNOYVIAAWINMZ-UHFFFAOYSA-M |
| XLogP | 1.22 |
| TPSA | 125.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|