C17H22ClN3O3 — CID 175341793
2-[1-(2-chloro-6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]ethanol (PubChem CID 175341793) has the molecular formula C17H22ClN3O3 and a molecular weight of 351.83 g/mol. Its IUPAC name is 2-[1-(2-chloro-6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]ethanol.
| Compound Name | 2-[1-(2-chloro-6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]ethanol |
|---|---|
| PubChem CID | 175341793 |
| Molecular Formula | C17H22ClN3O3 |
| Molecular Weight | 351.83 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 2-[1-(2-chloro-6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]ethanol |
| SMILES | COc1cc2nc(Cl)nc(N3CCC(CCO)CC3)c2cc1OC |
| InChI | InChI=1S/C17H22ClN3O3/c1-23-14-9-12-13(10-15(14)24-2)19-17(18)20-16(12)21-6-3-11(4-7-21)5-8-22/h9-11,22H,3-8H2,1-2H3 |
| InChIKey | QQZDNZKUHUEVKJ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 67.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.83 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |