About 2-[1-(2-chloro-6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]ethanol
2-[1-(2-chloro-6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]ethanol (PubChem CID 175341793) has the molecular formula C17H22ClN3O3
and a molecular weight of 351.83 g/mol. Its IUPAC name is 2-[1-(2-chloro-6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]ethanol.
Molecular Properties
| Compound Name | 2-[1-(2-chloro-6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]ethanol |
| PubChem CID | 175341793 |
| Molecular Formula | C17H22ClN3O3 |
| Molecular Weight | 351.83 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 2-[1-(2-chloro-6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]ethanol |
| SMILES | COc1cc2nc(Cl)nc(N3CCC(CCO)CC3)c2cc1OC |
| InChI | InChI=1S/C17H22ClN3O3/c1-23-14-9-12-13(10-15(14)24-2)19-17(18)20-16(12)21-6-3-11(4-7-21)5-8-22/h9-11,22H,3-8H2,1-2H3 |
| InChIKey | QQZDNZKUHUEVKJ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 67.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.83 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[1-(2-chloro-6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(2-chloro-6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]ethanol?
The IUPAC name of 2-[1-(2-chloro-6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]ethanol (CID 175341793) is 2-[1-(2-chloro-6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]ethanol.
What is the SMILES notation for 2-[1-(2-chloro-6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]ethanol?
The canonical SMILES for 2-[1-(2-chloro-6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]ethanol is COc1cc2nc(Cl)nc(N3CCC(CCO)CC3)c2cc1OC.
What is the InChIKey of 2-[1-(2-chloro-6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]ethanol?
The InChIKey is QQZDNZKUHUEVKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22ClN3O3/c1-23-14-9-12-13(10-15(14)24-2)19-17(18)20-16(12)21-6-3-11(4-7-21)5-8-22/h9-11,22H,3-8H2,1-2H3.
What are the key properties of 2-[1-(2-chloro-6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]ethanol?
2-[1-(2-chloro-6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]ethanol has a molecular weight of 351.83 g/mol, XLogP of 2.90, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(2-chloro-6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]ethanol is sourced from PubChem (CID 175341793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).