C25H25ClN6O6 — CID 22923434
3-[1-(2-chloro-6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]-1-ethyl-6-nitroquinazoline-2,4-dione (PubChem CID 22923434) has the molecular formula C25H25ClN6O6 and a molecular weight of 540.96 g/mol. Its IUPAC name is 3-[1-(2-chloro-6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]-1-ethyl-6-nitroquinazoline-2,4-dione.
| Compound Name | 3-[1-(2-chloro-6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]-1-ethyl-6-nitroquinazoline-2,4-dione |
|---|---|
| PubChem CID | 22923434 |
| Molecular Formula | C25H25ClN6O6 |
| Molecular Weight | 540.96 g/mol |
| Exact Mass | 540.15 |
| IUPAC Name | 3-[1-(2-chloro-6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]-1-ethyl-6-nitroquinazoline-2,4-dione |
| SMILES | CCn1c(=O)n(C2CCN(c3nc(Cl)nc4cc(OC)c(OC)cc34)CC2)c(=O)c2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C25H25ClN6O6/c1-4-30-19-6-5-15(32(35)36)11-17(19)23(33)31(25(30)34)14-7-9-29(10-8-14)22-16-12-20(37-2)21(38-3)13-18(16)27-24(26)28-22/h5-6,11-14H,4,7-10H2,1-3H3 |
| InChIKey | SGUQPGZUDHUFGU-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 134.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.96 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|