C16H20ClN3OS — CID 157040643
2-[1-(6-chloro-7-methoxyquinazolin-4-yl)piperidin-4-yl]ethanethiol (PubChem CID 157040643) has the molecular formula C16H20ClN3OS and a molecular weight of 337.88 g/mol. Its IUPAC name is 2-[1-(6-chloro-7-methoxyquinazolin-4-yl)piperidin-4-yl]ethanethiol.
| Compound Name | 2-[1-(6-chloro-7-methoxyquinazolin-4-yl)piperidin-4-yl]ethanethiol |
|---|---|
| PubChem CID | 157040643 |
| Molecular Formula | C16H20ClN3OS |
| Molecular Weight | 337.88 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 2-[1-(6-chloro-7-methoxyquinazolin-4-yl)piperidin-4-yl]ethanethiol |
| SMILES | COc1cc2ncnc(N3CCC(CCS)CC3)c2cc1Cl |
| InChI | InChI=1S/C16H20ClN3OS/c1-21-15-9-14-12(8-13(15)17)16(19-10-18-14)20-5-2-11(3-6-20)4-7-22/h8-11,22H,2-7H2,1H3 |
| InChIKey | CPZWGGPGYJMBMC-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 38.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.88 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|