C18H23ClN4OS — CID 157040832
6-chloro-7-methoxy-4-(2-methylsulfanyl-2,8-diazaspiro[4.5]decan-8-yl)quinazoline (PubChem CID 157040832) has the molecular formula C18H23ClN4OS and a molecular weight of 378.93 g/mol. Its IUPAC name is 6-chloro-7-methoxy-4-(2-methylsulfanyl-2,8-diazaspiro[4.5]decan-8-yl)quinazoline.
| Compound Name | 6-chloro-7-methoxy-4-(2-methylsulfanyl-2,8-diazaspiro[4.5]decan-8-yl)quinazoline |
|---|---|
| PubChem CID | 157040832 |
| Molecular Formula | C18H23ClN4OS |
| Molecular Weight | 378.93 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | 6-chloro-7-methoxy-4-(2-methylsulfanyl-2,8-diazaspiro[4.5]decan-8-yl)quinazoline |
| SMILES | COc1cc2ncnc(N3CCC4(CCN(SC)C4)CC3)c2cc1Cl |
| InChI | InChI=1S/C18H23ClN4OS/c1-24-16-10-15-13(9-14(16)19)17(21-12-20-15)22-6-3-18(4-7-22)5-8-23(11-18)25-2/h9-10,12H,3-8,11H2,1-2H3 |
| InChIKey | LHAIEMCTHNPIJN-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.93 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|