C19H28N3O4P — CID 138468207
2-[1-[7-(2-methylpropoxy)quinazolin-4-yl]piperidin-4-yl]ethylphosphonic acid (PubChem CID 138468207) has the molecular formula C19H28N3O4P and a molecular weight of 393.42 g/mol. Its IUPAC name is 2-[1-[7-(2-methylpropoxy)quinazolin-4-yl]piperidin-4-yl]ethylphosphonic acid.
| Compound Name | 2-[1-[7-(2-methylpropoxy)quinazolin-4-yl]piperidin-4-yl]ethylphosphonic acid |
|---|---|
| PubChem CID | 138468207 |
| Molecular Formula | C19H28N3O4P |
| Molecular Weight | 393.42 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | 2-[1-[7-(2-methylpropoxy)quinazolin-4-yl]piperidin-4-yl]ethylphosphonic acid |
| SMILES | CC(C)COc1ccc2c(N3CCC(CCP(=O)(O)O)CC3)ncnc2c1 |
| InChI | InChI=1S/C19H28N3O4P/c1-14(2)12-26-16-3-4-17-18(11-16)20-13-21-19(17)22-8-5-15(6-9-22)7-10-27(23,24)25/h3-4,11,13-15H,5-10,12H2,1-2H3,(H2,23,24,25) |
| InChIKey | FFSZJTICEKVBNB-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 95.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.42 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|