C16H20N3O5P — CID 138468657
2-[1-([1,3]dioxolo[4,5-g]quinazolin-8-yl)piperidin-4-yl]ethylphosphonic acid (PubChem CID 138468657) has the molecular formula C16H20N3O5P and a molecular weight of 365.33 g/mol. Its IUPAC name is 2-[1-([1,3]dioxolo[4,5-g]quinazolin-8-yl)piperidin-4-yl]ethylphosphonic acid.
| Compound Name | 2-[1-([1,3]dioxolo[4,5-g]quinazolin-8-yl)piperidin-4-yl]ethylphosphonic acid |
|---|---|
| PubChem CID | 138468657 |
| Molecular Formula | C16H20N3O5P |
| Molecular Weight | 365.33 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | 2-[1-([1,3]dioxolo[4,5-g]quinazolin-8-yl)piperidin-4-yl]ethylphosphonic acid |
| SMILES | O=P(O)(O)CCC1CCN(c2ncnc3cc4c(cc23)OCO4)CC1 |
| InChI | InChI=1S/C16H20N3O5P/c20-25(21,22)6-3-11-1-4-19(5-2-11)16-12-7-14-15(24-10-23-14)8-13(12)17-9-18-16/h7-9,11H,1-6,10H2,(H2,20,21,22) |
| InChIKey | QYTLEVIATYBZOY-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 105.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.33 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|