C23H20F3N5O6 — CID 58267808
1-[3-[6-methoxy-7-(2-methoxyethoxy)quinazolin-4-yl]oxyphenyl]-3-[3-(trifluoromethyl)-1,2-oxazol-5-yl]urea (PubChem CID 58267808) has the molecular formula C23H20F3N5O6 and a molecular weight of 519.44 g/mol. Its IUPAC name is 1-[3-[6-methoxy-7-(2-methoxyethoxy)quinazolin-4-yl]oxyphenyl]-3-[3-(trifluoromethyl)-1,2-oxazol-5-yl]urea.
| Compound Name | 1-[3-[6-methoxy-7-(2-methoxyethoxy)quinazolin-4-yl]oxyphenyl]-3-[3-(trifluoromethyl)-1,2-oxazol-5-yl]urea |
|---|---|
| PubChem CID | 58267808 |
| Molecular Formula | C23H20F3N5O6 |
| Molecular Weight | 519.44 g/mol |
| Exact Mass | 519.14 |
| IUPAC Name | 1-[3-[6-methoxy-7-(2-methoxyethoxy)quinazolin-4-yl]oxyphenyl]-3-[3-(trifluoromethyl)-1,2-oxazol-5-yl]urea |
| SMILES | COCCOc1cc2ncnc(Oc3cccc(NC(=O)Nc4cc(C(F)(F)F)no4)c3)c2cc1OC |
| InChI | InChI=1S/C23H20F3N5O6/c1-33-6-7-35-18-10-16-15(9-17(18)34-2)21(28-12-27-16)36-14-5-3-4-13(8-14)29-22(32)30-20-11-19(31-37-20)23(24,25)26/h3-5,8-12H,6-7H2,1-2H3,(H2,29,30,32) |
| InChIKey | QPEWNPAKBJXPNF-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 129.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.44 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|