C29H28F4N4O6 — CID 57329328
1-[4-[6-(2-ethoxyethoxy)-7-(2-methoxyethoxy)quinazolin-4-yl]oxyphenyl]-3-[4-fluoro-3-(trifluoromethyl)phenyl]urea (PubChem CID 57329328) has the molecular formula C29H28F4N4O6 and a molecular weight of 604.56 g/mol. Its IUPAC name is 1-[4-[6-(2-ethoxyethoxy)-7-(2-methoxyethoxy)quinazolin-4-yl]oxyphenyl]-3-[4-fluoro-3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[4-[6-(2-ethoxyethoxy)-7-(2-methoxyethoxy)quinazolin-4-yl]oxyphenyl]-3-[4-fluoro-3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 57329328 |
| Molecular Formula | C29H28F4N4O6 |
| Molecular Weight | 604.56 g/mol |
| Exact Mass | 604.19 |
| IUPAC Name | 1-[4-[6-(2-ethoxyethoxy)-7-(2-methoxyethoxy)quinazolin-4-yl]oxyphenyl]-3-[4-fluoro-3-(trifluoromethyl)phenyl]urea |
| SMILES | CCOCCOc1cc2c(Oc3ccc(NC(=O)Nc4ccc(F)c(C(F)(F)F)c4)cc3)ncnc2cc1OCCOC |
| InChI | InChI=1S/C29H28F4N4O6/c1-3-40-11-13-42-25-15-21-24(16-26(25)41-12-10-39-2)34-17-35-27(21)43-20-7-4-18(5-8-20)36-28(38)37-19-6-9-23(30)22(14-19)29(31,32)33/h4-9,14-17H,3,10-13H2,1-2H3,(H2,36,37,38) |
| InChIKey | CDKCLGPOWASCIG-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 113.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.56 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|