C30H30F4N4O6 — CID 57329239
1-[4-[7-(2-ethoxyethoxy)-6-(3-methoxypropoxy)quinazolin-4-yl]oxyphenyl]-3-[4-fluoro-3-(trifluoromethyl)phenyl]urea (PubChem CID 57329239) has the molecular formula C30H30F4N4O6 and a molecular weight of 618.58 g/mol. Its IUPAC name is 1-[4-[7-(2-ethoxyethoxy)-6-(3-methoxypropoxy)quinazolin-4-yl]oxyphenyl]-3-[4-fluoro-3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[4-[7-(2-ethoxyethoxy)-6-(3-methoxypropoxy)quinazolin-4-yl]oxyphenyl]-3-[4-fluoro-3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 57329239 |
| Molecular Formula | C30H30F4N4O6 |
| Molecular Weight | 618.58 g/mol |
| Exact Mass | 618.21 |
| IUPAC Name | 1-[4-[7-(2-ethoxyethoxy)-6-(3-methoxypropoxy)quinazolin-4-yl]oxyphenyl]-3-[4-fluoro-3-(trifluoromethyl)phenyl]urea |
| SMILES | CCOCCOc1cc2ncnc(Oc3ccc(NC(=O)Nc4ccc(F)c(C(F)(F)F)c4)cc3)c2cc1OCCCOC |
| InChI | InChI=1S/C30H30F4N4O6/c1-3-41-13-14-43-27-17-25-22(16-26(27)42-12-4-11-40-2)28(36-18-35-25)44-21-8-5-19(6-9-21)37-29(39)38-20-7-10-24(31)23(15-20)30(32,33)34/h5-10,15-18H,3-4,11-14H2,1-2H3,(H2,37,38,39) |
| InChIKey | XYFRZPKZXCPSSH-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 113.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.58 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|