C31H31BrF3N5O6 — CID 57329008
1-[4-bromo-3-(trifluoromethyl)phenyl]-3-[4-[6-(2-methoxyethoxy)-7-(2-morpholin-4-ylethoxy)quinazolin-4-yl]oxyphenyl]urea (PubChem CID 57329008) has the molecular formula C31H31BrF3N5O6 and a molecular weight of 706.52 g/mol. Its IUPAC name is 1-[4-bromo-3-(trifluoromethyl)phenyl]-3-[4-[6-(2-methoxyethoxy)-7-(2-morpholin-4-ylethoxy)quinazolin-4-yl]oxyphenyl]urea.
| Compound Name | 1-[4-bromo-3-(trifluoromethyl)phenyl]-3-[4-[6-(2-methoxyethoxy)-7-(2-morpholin-4-ylethoxy)quinazolin-4-yl]oxyphenyl]urea |
|---|---|
| PubChem CID | 57329008 |
| Molecular Formula | C31H31BrF3N5O6 |
| Molecular Weight | 706.52 g/mol |
| Exact Mass | 705.14 |
| IUPAC Name | 1-[4-bromo-3-(trifluoromethyl)phenyl]-3-[4-[6-(2-methoxyethoxy)-7-(2-morpholin-4-ylethoxy)quinazolin-4-yl]oxyphenyl]urea |
| SMILES | COCCOc1cc2c(Oc3ccc(NC(=O)Nc4ccc(Br)c(C(F)(F)F)c4)cc3)ncnc2cc1OCCN1CCOCC1 |
| InChI | InChI=1S/C31H31BrF3N5O6/c1-42-14-15-45-27-17-23-26(18-28(27)44-13-10-40-8-11-43-12-9-40)36-19-37-29(23)46-22-5-2-20(3-6-22)38-30(41)39-21-4-7-25(32)24(16-21)31(33,34)35/h2-7,16-19H,8-15H2,1H3,(H2,38,39,41) |
| InChIKey | DUSIACKUPJEKHL-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 116.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.52 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|