C30H29ClF3N5O4 — CID 164900961
1-[2-chloro-4-[6-methoxy-7-(3-pyrrolidin-1-ylpropoxy)quinazolin-4-yl]oxyphenyl]-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 164900961) has the molecular formula C30H29ClF3N5O4 and a molecular weight of 616.04 g/mol. Its IUPAC name is 1-[2-chloro-4-[6-methoxy-7-(3-pyrrolidin-1-ylpropoxy)quinazolin-4-yl]oxyphenyl]-3-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[2-chloro-4-[6-methoxy-7-(3-pyrrolidin-1-ylpropoxy)quinazolin-4-yl]oxyphenyl]-3-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 164900961 |
| Molecular Formula | C30H29ClF3N5O4 |
| Molecular Weight | 616.04 g/mol |
| Exact Mass | 615.19 |
| IUPAC Name | 1-[2-chloro-4-[6-methoxy-7-(3-pyrrolidin-1-ylpropoxy)quinazolin-4-yl]oxyphenyl]-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | COc1cc2c(Oc3ccc(NC(=O)Nc4ccc(C(F)(F)F)cc4)c(Cl)c3)ncnc2cc1OCCCN1CCCC1 |
| InChI | InChI=1S/C30H29ClF3N5O4/c1-41-26-16-22-25(17-27(26)42-14-4-13-39-11-2-3-12-39)35-18-36-28(22)43-21-9-10-24(23(31)15-21)38-29(40)37-20-7-5-19(6-8-20)30(32,33)34/h5-10,15-18H,2-4,11-14H2,1H3,(H2,37,38,40) |
| InChIKey | HPTVZCOLBBFDMI-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 97.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.04 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|