C25H30N6O6 — CID 58738969
1-[4-(6,7-dimethoxyquinazolin-4-yl)oxy-2-nitrophenyl]-3-(3-piperidin-1-ylpropyl)urea (PubChem CID 58738969) has the molecular formula C25H30N6O6 and a molecular weight of 510.55 g/mol. Its IUPAC name is 1-[4-(6,7-dimethoxyquinazolin-4-yl)oxy-2-nitrophenyl]-3-(3-piperidin-1-ylpropyl)urea.
| Compound Name | 1-[4-(6,7-dimethoxyquinazolin-4-yl)oxy-2-nitrophenyl]-3-(3-piperidin-1-ylpropyl)urea |
|---|---|
| PubChem CID | 58738969 |
| Molecular Formula | C25H30N6O6 |
| Molecular Weight | 510.55 g/mol |
| Exact Mass | 510.22 |
| IUPAC Name | 1-[4-(6,7-dimethoxyquinazolin-4-yl)oxy-2-nitrophenyl]-3-(3-piperidin-1-ylpropyl)urea |
| SMILES | COc1cc2ncnc(Oc3ccc(NC(=O)NCCCN4CCCCC4)c([N+](=O)[O-])c3)c2cc1OC |
| InChI | InChI=1S/C25H30N6O6/c1-35-22-14-18-20(15-23(22)36-2)27-16-28-24(18)37-17-7-8-19(21(13-17)31(33)34)29-25(32)26-9-6-12-30-10-4-3-5-11-30/h7-8,13-16H,3-6,9-12H2,1-2H3,(H2,26,29,32) |
| InChIKey | RFOAMPMPYCXNEI-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 140.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.55 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|