C26H22F4N4O4 — CID 57329083
1-[4-fluoro-3-(trifluoromethyl)phenyl]-3-[4-[7-(3-methoxypropoxy)quinazolin-4-yl]oxyphenyl]urea (PubChem CID 57329083) has the molecular formula C26H22F4N4O4 and a molecular weight of 530.48 g/mol. Its IUPAC name is 1-[4-fluoro-3-(trifluoromethyl)phenyl]-3-[4-[7-(3-methoxypropoxy)quinazolin-4-yl]oxyphenyl]urea.
| Compound Name | 1-[4-fluoro-3-(trifluoromethyl)phenyl]-3-[4-[7-(3-methoxypropoxy)quinazolin-4-yl]oxyphenyl]urea |
|---|---|
| PubChem CID | 57329083 |
| Molecular Formula | C26H22F4N4O4 |
| Molecular Weight | 530.48 g/mol |
| Exact Mass | 530.16 |
| IUPAC Name | 1-[4-fluoro-3-(trifluoromethyl)phenyl]-3-[4-[7-(3-methoxypropoxy)quinazolin-4-yl]oxyphenyl]urea |
| SMILES | COCCCOc1ccc2c(Oc3ccc(NC(=O)Nc4ccc(F)c(C(F)(F)F)c4)cc3)ncnc2c1 |
| InChI | InChI=1S/C26H22F4N4O4/c1-36-11-2-12-37-19-8-9-20-23(14-19)31-15-32-24(20)38-18-6-3-16(4-7-18)33-25(35)34-17-5-10-22(27)21(13-17)26(28,29)30/h3-10,13-15H,2,11-12H2,1H3,(H2,33,34,35) |
| InChIKey | NDGBGHFHLJGCOI-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.48 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|