C25H21BrF3N5O4 — CID 57329396
1-[4-[6-amino-7-(2-methoxyethoxy)quinazolin-4-yl]oxyphenyl]-3-[4-bromo-3-(trifluoromethyl)phenyl]urea (PubChem CID 57329396) has the molecular formula C25H21BrF3N5O4 and a molecular weight of 592.37 g/mol. Its IUPAC name is 1-[4-[6-amino-7-(2-methoxyethoxy)quinazolin-4-yl]oxyphenyl]-3-[4-bromo-3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[4-[6-amino-7-(2-methoxyethoxy)quinazolin-4-yl]oxyphenyl]-3-[4-bromo-3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 57329396 |
| Molecular Formula | C25H21BrF3N5O4 |
| Molecular Weight | 592.37 g/mol |
| Exact Mass | 591.07 |
| IUPAC Name | 1-[4-[6-amino-7-(2-methoxyethoxy)quinazolin-4-yl]oxyphenyl]-3-[4-bromo-3-(trifluoromethyl)phenyl]urea |
| SMILES | COCCOc1cc2ncnc(Oc3ccc(NC(=O)Nc4ccc(Br)c(C(F)(F)F)c4)cc3)c2cc1N |
| InChI | InChI=1S/C25H21BrF3N5O4/c1-36-8-9-37-22-12-21-17(11-20(22)30)23(32-13-31-21)38-16-5-2-14(3-6-16)33-24(35)34-15-4-7-19(26)18(10-15)25(27,28)29/h2-7,10-13H,8-9,30H2,1H3,(H2,33,34,35) |
| InChIKey | DBCBQRARNATECD-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 120.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.37 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|