C27H31N5O7S — CID 58267940
1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[3-[7-methoxy-6-(3-methylsulfonylpropoxy)quinazolin-4-yl]oxyphenyl]urea (PubChem CID 58267940) has the molecular formula C27H31N5O7S and a molecular weight of 569.64 g/mol. Its IUPAC name is 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[3-[7-methoxy-6-(3-methylsulfonylpropoxy)quinazolin-4-yl]oxyphenyl]urea.
| Compound Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[3-[7-methoxy-6-(3-methylsulfonylpropoxy)quinazolin-4-yl]oxyphenyl]urea |
|---|---|
| PubChem CID | 58267940 |
| Molecular Formula | C27H31N5O7S |
| Molecular Weight | 569.64 g/mol |
| Exact Mass | 569.19 |
| IUPAC Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[3-[7-methoxy-6-(3-methylsulfonylpropoxy)quinazolin-4-yl]oxyphenyl]urea |
| SMILES | COc1cc2ncnc(Oc3cccc(NC(=O)Nc4cc(C(C)(C)C)on4)c3)c2cc1OCCCS(C)(=O)=O |
| InChI | InChI=1S/C27H31N5O7S/c1-27(2,3)23-15-24(32-39-23)31-26(33)30-17-8-6-9-18(12-17)38-25-19-13-22(37-10-7-11-40(5,34)35)21(36-4)14-20(19)28-16-29-25/h6,8-9,12-16H,7,10-11H2,1-5H3,(H2,30,31,32,33) |
| InChIKey | FFXXPDMJLAVWOS-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 154.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.64 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|