C26H27N5O6 — CID 87187452
1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[3-[7-methoxy-6-(oxiran-2-ylmethoxy)quinazolin-4-yl]oxyphenyl]urea (PubChem CID 87187452) has the molecular formula C26H27N5O6 and a molecular weight of 505.53 g/mol. Its IUPAC name is 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[3-[7-methoxy-6-(oxiran-2-ylmethoxy)quinazolin-4-yl]oxyphenyl]urea.
| Compound Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[3-[7-methoxy-6-(oxiran-2-ylmethoxy)quinazolin-4-yl]oxyphenyl]urea |
|---|---|
| PubChem CID | 87187452 |
| Molecular Formula | C26H27N5O6 |
| Molecular Weight | 505.53 g/mol |
| Exact Mass | 505.20 |
| IUPAC Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[3-[7-methoxy-6-(oxiran-2-ylmethoxy)quinazolin-4-yl]oxyphenyl]urea |
| SMILES | COc1cc2ncnc(Oc3cccc(NC(=O)Nc4cc(C(C)(C)C)on4)c3)c2cc1OCC1CO1 |
| InChI | InChI=1S/C26H27N5O6/c1-26(2,3)22-11-23(31-37-22)30-25(32)29-15-6-5-7-16(8-15)36-24-18-9-21(35-13-17-12-34-17)20(33-4)10-19(18)27-14-28-24/h5-11,14,17H,12-13H2,1-4H3,(H2,29,30,31,32) |
| InChIKey | DTSGDKOALQDWKJ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 133.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.53 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|