C27H29IN6O5 — CID 87187454
1-(5-tert-butyl-1,2-oxazol-3-yl)-1-iodo-3-[3-(7-methoxy-6-pyrrolidin-3-yloxyquinazolin-4-yl)oxyphenyl]urea (PubChem CID 87187454) has the molecular formula C27H29IN6O5 and a molecular weight of 644.47 g/mol. Its IUPAC name is 1-(5-tert-butyl-1,2-oxazol-3-yl)-1-iodo-3-[3-(7-methoxy-6-pyrrolidin-3-yloxyquinazolin-4-yl)oxyphenyl]urea.
| Compound Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-1-iodo-3-[3-(7-methoxy-6-pyrrolidin-3-yloxyquinazolin-4-yl)oxyphenyl]urea |
|---|---|
| PubChem CID | 87187454 |
| Molecular Formula | C27H29IN6O5 |
| Molecular Weight | 644.47 g/mol |
| Exact Mass | 644.12 |
| IUPAC Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-1-iodo-3-[3-(7-methoxy-6-pyrrolidin-3-yloxyquinazolin-4-yl)oxyphenyl]urea |
| SMILES | COc1cc2ncnc(Oc3cccc(NC(=O)N(I)c4cc(C(C)(C)C)on4)c3)c2cc1OC1CCNC1 |
| InChI | InChI=1S/C27H29IN6O5/c1-27(2,3)23-13-24(33-39-23)34(28)26(35)32-16-6-5-7-17(10-16)38-25-19-11-22(37-18-8-9-29-14-18)21(36-4)12-20(19)30-15-31-25/h5-7,10-13,15,18,29H,8-9,14H2,1-4H3,(H,32,35) |
| InChIKey | NYBBJMAUUYZUQO-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 123.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.47 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|