C24H25N5O6 — CID 57393063
2-[4-[7-methoxy-6-(2-methoxyethoxy)quinazolin-4-yl]oxypyrazol-1-yl]-N-(3-methoxyphenyl)acetamide (PubChem CID 57393063) has the molecular formula C24H25N5O6 and a molecular weight of 479.49 g/mol. Its IUPAC name is 2-[4-[7-methoxy-6-(2-methoxyethoxy)quinazolin-4-yl]oxypyrazol-1-yl]-N-(3-methoxyphenyl)acetamide.
| Compound Name | 2-[4-[7-methoxy-6-(2-methoxyethoxy)quinazolin-4-yl]oxypyrazol-1-yl]-N-(3-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 57393063 |
| Molecular Formula | C24H25N5O6 |
| Molecular Weight | 479.49 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | 2-[4-[7-methoxy-6-(2-methoxyethoxy)quinazolin-4-yl]oxypyrazol-1-yl]-N-(3-methoxyphenyl)acetamide |
| SMILES | COCCOc1cc2c(Oc3cnn(CC(=O)Nc4cccc(OC)c4)c3)ncnc2cc1OC |
| InChI | InChI=1S/C24H25N5O6/c1-31-7-8-34-22-10-19-20(11-21(22)33-3)25-15-26-24(19)35-18-12-27-29(13-18)14-23(30)28-16-5-4-6-17(9-16)32-2/h4-6,9-13,15H,7-8,14H2,1-3H3,(H,28,30) |
| InChIKey | QPNALTDCQOTWLI-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.49 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|