C26H29F3N4O2Si — CID 170672739
6-(3,3-difluoro-1-methylpiperidin-4-yl)oxy-N-[2-fluoro-3-(2-trimethylsilylethynyl)phenyl]-7-methoxyquinazolin-4-amine (PubChem CID 170672739) has the molecular formula C26H29F3N4O2Si and a molecular weight of 514.62 g/mol. Its IUPAC name is 6-(3,3-difluoro-1-methylpiperidin-4-yl)oxy-N-[2-fluoro-3-(2-trimethylsilylethynyl)phenyl]-7-methoxyquinazolin-4-amine.
| Compound Name | 6-(3,3-difluoro-1-methylpiperidin-4-yl)oxy-N-[2-fluoro-3-(2-trimethylsilylethynyl)phenyl]-7-methoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 170672739 |
| Molecular Formula | C26H29F3N4O2Si |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 514.20 |
| IUPAC Name | 6-(3,3-difluoro-1-methylpiperidin-4-yl)oxy-N-[2-fluoro-3-(2-trimethylsilylethynyl)phenyl]-7-methoxyquinazolin-4-amine |
| SMILES | COc1cc2ncnc(Nc3cccc(C#C[Si](C)(C)C)c3F)c2cc1OC1CCN(C)CC1(F)F |
| InChI | InChI=1S/C26H29F3N4O2Si/c1-33-11-9-23(26(28,29)15-33)35-22-13-18-20(14-21(22)34-2)30-16-31-25(18)32-19-8-6-7-17(24(19)27)10-12-36(3,4)5/h6-8,13-14,16,23H,9,11,15H2,1-5H3,(H,30,31,32) |
| InChIKey | CJWWYJHJTVLCQZ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|