C28H33FN4O2Si — CID 166538835
tert-butyl (3R)-3-[4-[2-fluoro-3-(2-trimethylsilylethynyl)anilino]quinazolin-6-yl]pyrrolidine-1-carboxylate (PubChem CID 166538835) has the molecular formula C28H33FN4O2Si and a molecular weight of 504.68 g/mol. Its IUPAC name is tert-butyl (3R)-3-[4-[2-fluoro-3-(2-trimethylsilylethynyl)anilino]quinazolin-6-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[4-[2-fluoro-3-(2-trimethylsilylethynyl)anilino]quinazolin-6-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 166538835 |
| Molecular Formula | C28H33FN4O2Si |
| Molecular Weight | 504.68 g/mol |
| Exact Mass | 504.24 |
| IUPAC Name | tert-butyl (3R)-3-[4-[2-fluoro-3-(2-trimethylsilylethynyl)anilino]quinazolin-6-yl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](c2ccc3ncnc(Nc4cccc(C#C[Si](C)(C)C)c4F)c3c2)C1 |
| InChI | InChI=1S/C28H33FN4O2Si/c1-28(2,3)35-27(34)33-14-12-21(17-33)20-10-11-23-22(16-20)26(31-18-30-23)32-24-9-7-8-19(25(24)29)13-15-36(4,5)6/h7-11,16,18,21H,12,14,17H2,1-6H3,(H,30,31,32)/t21-/m0/s1 |
| InChIKey | ABMIWSGWLFXIBE-NRFANRHFSA-N |
| XLogP | 6.47 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.68 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|