C23H21F3N4O — CID 174175225
6-[(4R)-3,3-difluoro-1-methylpiperidin-4-yl]-N-(3-ethynyl-2-fluorophenyl)-7-methoxyquinazolin-4-amine (PubChem CID 174175225) has the molecular formula C23H21F3N4O and a molecular weight of 426.44 g/mol. Its IUPAC name is 6-[(4R)-3,3-difluoro-1-methylpiperidin-4-yl]-N-(3-ethynyl-2-fluorophenyl)-7-methoxyquinazolin-4-amine.
| Compound Name | 6-[(4R)-3,3-difluoro-1-methylpiperidin-4-yl]-N-(3-ethynyl-2-fluorophenyl)-7-methoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 174175225 |
| Molecular Formula | C23H21F3N4O |
| Molecular Weight | 426.44 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | 6-[(4R)-3,3-difluoro-1-methylpiperidin-4-yl]-N-(3-ethynyl-2-fluorophenyl)-7-methoxyquinazolin-4-amine |
| SMILES | C#Cc1cccc(Nc2ncnc3cc(OC)c([C@H]4CCN(C)CC4(F)F)cc23)c1F |
| InChI | InChI=1S/C23H21F3N4O/c1-4-14-6-5-7-18(21(14)24)29-22-16-10-15(17-8-9-30(2)12-23(17,25)26)20(31-3)11-19(16)27-13-28-22/h1,5-7,10-11,13,17H,8-9,12H2,2-3H3,(H,27,28,29)/t17-/m1/s1 |
| InChIKey | HWIIURKFDIBTCC-QGZVFWFLSA-N |
| XLogP | 4.56 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.44 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|