C25H25F5N2O5Si — CID 142555244
2-[3-[6,7-bis[2-(difluoromethoxy)ethoxy]quinazolin-4-yl]oxy-2-fluorophenyl]ethynyl-trimethylsilane (PubChem CID 142555244) has the molecular formula C25H25F5N2O5Si and a molecular weight of 556.56 g/mol. Its IUPAC name is 2-[3-[6,7-bis[2-(difluoromethoxy)ethoxy]quinazolin-4-yl]oxy-2-fluorophenyl]ethynyl-trimethylsilane.
| Compound Name | 2-[3-[6,7-bis[2-(difluoromethoxy)ethoxy]quinazolin-4-yl]oxy-2-fluorophenyl]ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 142555244 |
| Molecular Formula | C25H25F5N2O5Si |
| Molecular Weight | 556.56 g/mol |
| Exact Mass | 556.15 |
| IUPAC Name | 2-[3-[6,7-bis[2-(difluoromethoxy)ethoxy]quinazolin-4-yl]oxy-2-fluorophenyl]ethynyl-trimethylsilane |
| SMILES | C[Si](C)(C)C#Cc1cccc(Oc2ncnc3cc(OCCOC(F)F)c(OCCOC(F)F)cc23)c1F |
| InChI | InChI=1S/C25H25F5N2O5Si/c1-38(2,3)12-7-16-5-4-6-19(22(16)26)37-23-17-13-20(33-8-10-35-24(27)28)21(14-18(17)31-15-32-23)34-9-11-36-25(29)30/h4-6,13-15,24-25H,8-11H2,1-3H3 |
| InChIKey | NOSWEJCIUKNZPG-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 71.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.56 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|