C24H24FN3O6 — CID 141435855
5-[[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]oxymethyl]-3-(4-fluorophenyl)-1,2-oxazole (PubChem CID 141435855) has the molecular formula C24H24FN3O6 and a molecular weight of 469.47 g/mol. Its IUPAC name is 5-[[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]oxymethyl]-3-(4-fluorophenyl)-1,2-oxazole.
| Compound Name | 5-[[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]oxymethyl]-3-(4-fluorophenyl)-1,2-oxazole |
|---|---|
| PubChem CID | 141435855 |
| Molecular Formula | C24H24FN3O6 |
| Molecular Weight | 469.47 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | 5-[[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]oxymethyl]-3-(4-fluorophenyl)-1,2-oxazole |
| SMILES | COCCOc1cc2ncnc(OCc3cc(-c4ccc(F)cc4)no3)c2cc1OCCOC |
| InChI | InChI=1S/C24H24FN3O6/c1-29-7-9-31-22-12-19-21(13-23(22)32-10-8-30-2)26-15-27-24(19)33-14-18-11-20(28-34-18)16-3-5-17(25)6-4-16/h3-6,11-13,15H,7-10,14H2,1-2H3 |
| InChIKey | ODPPLSJZBVPNEE-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 97.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.47 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|