C16H11ClFNO2 — CID 134010105
5-[(2-chloro-4-fluorophenoxy)methyl]-3-phenyl-1,2-oxazole (PubChem CID 134010105) has the molecular formula C16H11ClFNO2 and a molecular weight of 303.72 g/mol. Its IUPAC name is 5-[(2-chloro-4-fluorophenoxy)methyl]-3-phenyl-1,2-oxazole.
| Compound Name | 5-[(2-chloro-4-fluorophenoxy)methyl]-3-phenyl-1,2-oxazole |
|---|---|
| PubChem CID | 134010105 |
| Molecular Formula | C16H11ClFNO2 |
| Molecular Weight | 303.72 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | 5-[(2-chloro-4-fluorophenoxy)methyl]-3-phenyl-1,2-oxazole |
| SMILES | Fc1ccc(OCc2cc(-c3ccccc3)no2)c(Cl)c1 |
| InChI | InChI=1S/C16H11ClFNO2/c17-14-8-12(18)6-7-16(14)20-10-13-9-15(19-21-13)11-4-2-1-3-5-11/h1-9H,10H2 |
| InChIKey | MYAKOMIFGYTLCP-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.72 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |