C16H14N2O2 — CID 61027686
2-[(3-phenyl-1,2-oxazol-5-yl)methoxy]aniline (PubChem CID 61027686) has the molecular formula C16H14N2O2 and a molecular weight of 266.30 g/mol. Its IUPAC name is 2-[(3-phenyl-1,2-oxazol-5-yl)methoxy]aniline.
| Compound Name | 2-[(3-phenyl-1,2-oxazol-5-yl)methoxy]aniline |
|---|---|
| PubChem CID | 61027686 |
| Molecular Formula | C16H14N2O2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 2-[(3-phenyl-1,2-oxazol-5-yl)methoxy]aniline |
| SMILES | Nc1ccccc1OCc1cc(-c2ccccc2)no1 |
| InChI | InChI=1S/C16H14N2O2/c17-14-8-4-5-9-16(14)19-11-13-10-15(18-20-13)12-6-2-1-3-7-12/h1-10H,11,17H2 |
| InChIKey | SYPBPIMCALDQHG-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|