C27H22N2O5 — CID 2748900
[3,5-bis[(3-phenyl-1,2-oxazol-5-yl)methoxy]phenyl]methanol (PubChem CID 2748900) has the molecular formula C27H22N2O5 and a molecular weight of 454.48 g/mol. Its IUPAC name is [3,5-bis[(3-phenyl-1,2-oxazol-5-yl)methoxy]phenyl]methanol.
| Compound Name | [3,5-bis[(3-phenyl-1,2-oxazol-5-yl)methoxy]phenyl]methanol |
|---|---|
| PubChem CID | 2748900 |
| Molecular Formula | C27H22N2O5 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | [3,5-bis[(3-phenyl-1,2-oxazol-5-yl)methoxy]phenyl]methanol |
| SMILES | OCc1cc(OCc2cc(-c3ccccc3)no2)cc(OCc2cc(-c3ccccc3)no2)c1 |
| InChI | InChI=1S/C27H22N2O5/c30-16-19-11-22(31-17-24-14-26(28-33-24)20-7-3-1-4-8-20)13-23(12-19)32-18-25-15-27(29-34-25)21-9-5-2-6-10-21/h1-15,30H,16-18H2 |
| InChIKey | MUNYKAKNYPUVNS-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 90.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |