C16H23N3O4 — CID 149497994
6,7-bis(2-methoxyethoxy)-N,N-dimethylquinazolin-4-amine (PubChem CID 149497994) has the molecular formula C16H23N3O4 and a molecular weight of 321.38 g/mol. Its IUPAC name is 6,7-bis(2-methoxyethoxy)-N,N-dimethylquinazolin-4-amine.
| Compound Name | 6,7-bis(2-methoxyethoxy)-N,N-dimethylquinazolin-4-amine |
|---|---|
| PubChem CID | 149497994 |
| Molecular Formula | C16H23N3O4 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 6,7-bis(2-methoxyethoxy)-N,N-dimethylquinazolin-4-amine |
| SMILES | COCCOc1cc2ncnc(N(C)C)c2cc1OCCOC |
| InChI | InChI=1S/C16H23N3O4/c1-19(2)16-12-9-14(22-7-5-20-3)15(23-8-6-21-4)10-13(12)17-11-18-16/h9-11H,5-8H2,1-4H3 |
| InChIKey | ZGKSZBRHXRWXJN-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 65.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|