C15H21ClN3O2- — CID 160550418
6,7-diethoxy-N-ethyl-N-methylquinazolin-4-amine chloride (PubChem CID 160550418) has the molecular formula C15H21ClN3O2- and a molecular weight of 310.81 g/mol. Its IUPAC name is 6,7-diethoxy-N-ethyl-N-methylquinazolin-4-amine chloride.
| Compound Name | 6,7-diethoxy-N-ethyl-N-methylquinazolin-4-amine chloride |
|---|---|
| PubChem CID | 160550418 |
| Molecular Formula | C15H21ClN3O2- |
| Molecular Weight | 310.81 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 6,7-diethoxy-N-ethyl-N-methylquinazolin-4-amine chloride |
| SMILES | CCOc1cc2ncnc(N(C)CC)c2cc1OCC.[Cl-] |
| InChI | InChI=1S/C15H21N3O2.ClH/c1-5-18(4)15-11-8-13(19-6-2)14(20-7-3)9-12(11)16-10-17-15;/h8-10H,5-7H2,1-4H3;1H/p-1 |
| InChIKey | YHTAZQCZJRVNIQ-UHFFFAOYSA-M |
| XLogP | -0.11 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.81 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |