C18H21N3O6 — CID 70483776
2-[1-[(6,7-dimethoxyquinazolin-4-yl)-ethylamino]propylidene]propanedioic acid (PubChem CID 70483776) has the molecular formula C18H21N3O6 and a molecular weight of 375.38 g/mol. Its IUPAC name is 2-[1-[(6,7-dimethoxyquinazolin-4-yl)-ethylamino]propylidene]propanedioic acid.
| Compound Name | 2-[1-[(6,7-dimethoxyquinazolin-4-yl)-ethylamino]propylidene]propanedioic acid |
|---|---|
| PubChem CID | 70483776 |
| Molecular Formula | C18H21N3O6 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | 2-[1-[(6,7-dimethoxyquinazolin-4-yl)-ethylamino]propylidene]propanedioic acid |
| SMILES | CCC(=C(C(=O)O)C(=O)O)N(CC)c1ncnc2cc(OC)c(OC)cc12 |
| InChI | InChI=1S/C18H21N3O6/c1-5-12(15(17(22)23)18(24)25)21(6-2)16-10-7-13(26-3)14(27-4)8-11(10)19-9-20-16/h7-9H,5-6H2,1-4H3,(H,22,23)(H,24,25) |
| InChIKey | XVVGOTLZHOJGEK-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 122.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|